 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1/C(=O)N(c2nc(-c3ccccc3)cs2)N=C1C | | Value: | =1100nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C/C(c1ccccc1)c1ccccc1 | | Value: | =13500nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C/c1ccc(-c2ccccc2)cc1 | | Value: | =12900nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C/c1ccc2ccccc2c1 | | Value: | =12600nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C/c1ncc[nH]1 | | Value: | =15800nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1CC(=O)C1C(=O)N(c2nc(-c3ccccc3)cs2)N=C1C | | Value: | =63100nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1C(=O)C(=O)C1C(=O)N(c2nc(-c3ccccc3)cs2)N=C1C | | Value: | =85100nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccc(N(C)C)cc3)c2)N=C1C | | Value: | =800nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccccc3)c2)N=C1C | | Value: | =9100nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccncc3)c2)N=C1C | | Value: | =1700nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3cccs3)c2)N=C1C | | Value: | =30900nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3cccc(N)c3)c2)N=C1C | | Value: | =1300nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccc(C(C)C)cc3)c2)N=C1C | | Value: | =1200nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cccc(-c3ccc(N(C)C)cc3)c2)N=C1C | | Value: | =1300nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2cc(O)cc(-c3ccc(N(C)C)cc3)c2)C(=O)/C1=N\Nc1ccc2ccccc2c1 | | Value: | =1000nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of FITC-BIM from recombinant N-terminal GST-tagged human BAX expressed in Escherichia coli after 30 mins by fluorescence polarization assay | | Type: | Ki | | SMILES: | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C/c1ccccc1 | | Value: | =2500nM | | Source: | Homo sapiens |
|
 | | Assay: | Activation of Bax in human HuH7 cells assessed as inhibition of mitochondrial accumulation of fluorescent probe Mitotracker Red after 12 to 72 hrs by spectrophotometric analysis | | Type: | EC50 | | SMILES: | CCOc1ccccc1N/N=C1/C(=O)N(c2nc(-c3ccccc3)cs2)N=C1C | | Value: | =8200nM | | Source: | Homo sapiens |
|
 | | Assay: | Activation of Bax in human HuH7 cells assessed as inhibition of mitochondrial accumulation of fluorescent probe Mitotracker Red after 12 to 72 hrs by spectrophotometric analysis | | Type: | EC50 | | SMILES: | CCOc1ccccc1N/N=C1\C(=O)N(c2cc(O)cc(-c3ccc(N(C)C)cc3)c2)N=C1C | | Value: | =700nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of fluorescent Bak BH3 peptide domain from human recombinant Bax by competition fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=[N+]([O-])c1ccc2c(c1)C(=Cc1ccccc1O)c1ccccc1-2 | | Value: | =43nM | | Source: | Homo sapiens |
|
 | | Assay: | Activation of Bax in human SMMC7721 cells | | Type: | IC50 | | SMILES: | O=C(N/N=C/c1ccc2c(c1)OCO2)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O | | Value: | =3000nM | | Source: | Homo sapiens |
|
