 | | Assay: | Inhibition of BRCA1 assessed as BRCT-BACH1 interaction | | Type: | Ki | | SMILES: | O=C1c2ccccc2S(=O)(=O)c2cc(N3CCC(Cc4ccccc4)CC3)ccc21 | | Value: | =38000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of BRCA1 assessed as BRCT-BACH1 interaction | | Type: | Ki | | SMILES: | NC(=O)C1CCN(c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)CC1 | | Value: | =30000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of BRCA1 assessed as BRCT-BACH1 interaction | | Type: | Ki | | SMILES: | CC1CCN(c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)CC1 | | Value: | =39000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CN(C)[C@@H]1C(O)=C(C(N)=O)C(=O)[C@]2(O)C(O)=C3C(=O)c4c(O)cccc4[C@](C)(O)[C@H]3C[C@@H]12.CS(=O)(=O)O | | Value: | =7943.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | COc1cc(-c2ccc(/N=N\c3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c4c3O)c(OC)c2)ccc1/N=N\c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O | | Value: | =19952.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C1Nc2ccc(I)cc2/C1=C/c1cc(Br)c(O)c(Br)c1 | | Value: | =31622.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C1c2ccccc2-c2onc3ccc(NCCCn4ccnc4)c1c23 | | Value: | =631nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C(Nc1cc(C(=O)Nc2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])cc(C(=O)Nc2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])c1)Nc1cc(C(=O)Nc2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])cc(C(=O)Nc2ccc(S(=O)(=O)[O-])cc2S(=O)(=O)[O-])c1.[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+] | | Value: | =631nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Br-] | | Value: | =19952.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | Cn1c(NC(=O)c2ccccc2Br)cc(=O)n(C)c1=O | | Value: | =10000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CC[C@@]1(O)CC(O)c2c(cc3c(c2O)C(=O)c2c(O)ccc(O)c2C3=O)C1C(=O)OC | | Value: | =3981.1nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CN(N=O)c1ccc(O)c(O)c1 | | Value: | =6309.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C1CC(/C=C/c2ccco2)=Nc2ccccc2N1 | | Value: | =39810.7nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CN1C(=O)/C(=N\CCO)c2c3ccccc3c(O)c3cccc1c23 | | Value: | =25118.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | Cc1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O | | Value: | =39810.7nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | CC1N(C)c2cc(NC(=O)c3ccco3)ccc2C1(C)C | | Value: | =31622.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C1c2ccc(O)c(O)c2C(=O)c2c(O)ccc(O)c21 | | Value: | =31622.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C1c2ccccc2C(=O)c2c(O)c(O)cc(O)c21 | | Value: | =39810.7nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | c1coc(C2Nc3cccc4cccc(c34)N2)c1 | | Value: | =6309.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BRCT-Phosphoprotein Interaction (Red Fluorophore). (Class of assay: confirmatory) [Related pubchem assays: 875 ] | | Type: | Potency | | SMILES: | O=C(O)/C=C\c1c2ccc(=O)c(O)c-2oc2c(O)c(O)ccc12 | | Value: | =1000nM | | Source: | Homo sapiens |
|
