Other Name(s): HMGB-1
Assay:Binding affinity to HMGB1 (unknown origin)
Type:Kd
SMILES:CC1(C)[C@@H](O[C@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C
Value:=150000nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 B box region (90 to 175 residues) (unknown origin) expressed Escherichia coli after 5 mins by fluorescence-based assay
Type:Kd
SMILES:CC1(C)[C@@H](O[C@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C
Value:=87000nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 A box region (1 to 89 residues) (unknown origin) expressed Escherichia coli after 5 mins by fluorescence-based assay
Type:Kd
SMILES:CC1(C)[C@@H](O[C@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C
Value:=103000nM
Source:Homo sapiens
Assay:Binding affinity to N-terminal 6His-tagged HMGB1 Bj region (88 to 181 residues) (unknown origin) expressed in Escherichia coli JM109 by SPR assay
Type:Kd
SMILES:CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1
Value:=24nM
Source:Homo sapiens
Assay:Binding affinity to N-terminal 6His-tagged HMGB1 AI region (1 to 87 residues) (unknown origin) expressed in Escherichia coli JM109 by SPR assay
Type:Kd
SMILES:CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1
Value:=500nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 box A (unknown origin)
Type:Kd
SMILES:O=C(O)c1ccccc1O
Value:=1000nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 box A (unknown origin)
Type:Kd
SMILES:NCCc1cccc(C(=O)O)c1O
Value:=1.48nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 box B (unknown origin)
Type:Kd
SMILES:O=C(O)c1ccccc1O
Value:=1000nM
Source:Homo sapiens
Assay:Binding affinity to recombinant HMGB1 box B (unknown origin)
Type:Kd
SMILES:NCCc1cccc(C(=O)O)c1O
Value:=1.48nM
Source:Homo sapiens
Assay:Dissociation constant of compound from High-mobility group box 1 protein (HMGB1)
Type:Kd
SMILES:[H]O[C@@H]1[C@@H](O[H])[C@H](O[C@@H]2[C@@H](O[H])[C@H](O[H])[C@H](O[C@@H]2O[C@H]3CC[C@@]4(C)[C@@]([H])(CC[C@]5(C)[C@]4([H])C(=O)C=C6[C@]7([H])C[C@](C)(CC[C@]7(C)CC[C@@]56C)C(=O)O[H])C3(C)C)C(=O)O[H])O[C@@H]([C@H]1O[H])C(=O)O[H]
Value:~150000nM
Source:
Assay:Inhibitory concentration of compound against HMGB1
Type:IC50
SMILES:NN(CC1=CC=CC=C1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)NN(CCC(O)=O)C(N)=O
Value:=90nM
Source:
Assay:Inhibitory concentration of compound against HMGB1
Type:IC50
SMILES:N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(N)=O
Value:~68.5nM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1 was measured
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:~150uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1A was measured (with a complex of HMGB 1A: compound at a ratio of 1:4)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=103uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1B was measured (with a complex of HMGB 1B: compound at a ratio of 1:4)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=87uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1A was measured (with a complex of HMGB 1A: compound at a ratio of 1:2)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=156uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1B was measured (with a complex of HMGB 1B: compound at a ratio of 1:2)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=156uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1A was measured (with a complex of HMGB 1A: compound at a ratio of 1:1)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=170uM
Source:
Assay:Dissociation constant of compound towards High mobility group box 1B was measured (with a complex of HMGB 1B: compound at a ratio of 1:1)
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)[C@]4([H])[C@@]5(C)CCC(OC6OC(C(O)C(O)C6OC7OC(C(O)C(O)C7O)C(O)=O)C(O)=O)C(C)(C)C5CC[C@@]34C)C(O)=O
Value:=140uM
Source:
Assay:Dissociation constant of compound towards High-mobility group box 1 was determined
Type:Kd
SMILES:[H][C@@]12C[C@](C)(CC[C@]1(C)CC[C@]1(C)C2=CC(=O)C2[C@@]3(C)CC[C@H](OC4OC(C(O)C(O)C4OC4OC(C(O)C(O)C4O)C(O)=O)C(O)=O)C(C)(C)C3CC[C@@]12C)C(O)=O
Value:~150uM
Source:

Note: If you'd like to learn how our AI-powered BDE-Chem can help design therapeutic molecules against the HMGB1 target, that break through the existing patents, at a cost 90% lower than traditional approaches, please feel free to contact us at BD@silexon.ai

Molecules for More Common Targets

ABCB1 | ABCG2 | ACE2 | AHR | AKT1 | ALK | AR | ATM | BAX | BCL2 | BCL2L1 | BRAF | BRCA1 | CASP3 | CASP9 | CCL5 | CCND1 | CD274 | CD4 | CDKN1A | CXCL8 | CXCR4 | DNMT1 | EGF | EGFR | EP300 | ERBB2 | ESR1 | EZH2 | FN1 | FOXO3 | HDAC9 | HGF | HMGB1 | HSP90AA1 | HSPA5 | IDO1 | IGF1 | IGF1R | IL17A | IL6 | INS | JUN | KRAS | MAPK1 | MAPK14 | MAPK3 | MAPK8 | MAPT | MCL1 | MMP9 | MTOR | MYC | NFE2L2 | NLRP3 | NOTCH1 | PARP1 | PCNA | PDCD1 | PLK1 | PRKAA1 | PRKAA2 | PTEN | PTGS2 | PTK2 | RELA | SIRT1 | SRC | STAT1 | STAT3 | STAT5A | TERT | TLR4 | TNF | TP53 | TXN | VEGFA | YAP1