 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | O=C(Oc1cncc(Cl)c1)c1ccco1 | Value: | =44668.4nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CC(=O)c1ccc(NC(=O)c2ccc3c(c2)N(Cc2cccc(Cl)c2)C(=O)c2ccccc2[S+]3[O-])cc1 | Value: | =31622.8nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | O=c1c(-c2cc(O)c(O)c(O)c2)coc2cc(O)c(O)c(O)c12 | Value: | =7079.5nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CCOC(=O)/C(=C\c1cccnc1)C(=O)c1cc(C(C)=O)c(Nc2ccccc2)s1 | Value: | =35481.3nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CCCN1C(=O)/C(=C/c2ccc(N3CCCC3)c(C)c2)NC1=S | Value: | =10000nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CCc1ccc(-n2c(=O)c3ccc(C(=O)NCCc4ccccc4)cc3n(CC(N)=O)c2=O)cc1 | Value: | =28183.8nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | O=c1oc2ccccc2c(N2CCC(c3ccccc3)CC2)c1[N+](=O)[O-] | Value: | =44668.4nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | Cc1ccc2nc(N(CCCN(C)C)C(=O)c3ccc(Br)s3)sc2c1 | Value: | =12589.3nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | O=C(CSc1ccc(Cl)cc1)Nc1ccc(-c2nc3ccccc3[nH]2)cc1 | Value: | =39810.7nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | COc1cccc(C(=O)Nc2cccc(NC(=O)c3ccc(Cl)cc3Cl)c2)c1 | Value: | =14125.4nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | N#CCCn1cc(/C=C/C(=O)O)c(-c2ccc(F)cc2)n1 | Value: | =8912.5nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CC[n+]1c(C)sc2c(C)cc(C)cc21.[I-] | Value: | =10000nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | NC(=O)c1ccc(N=Nc2c(O)nc3ccccc3c2O)cc1 | Value: | =25.1nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CCN1C[C@@]2(OC(=O)c3ccccc3NC(C)=O)CCC(OC)[C@@]34C5CC6C(OC)C[C@@](O)(C(CC32)[C@@H]14)C5(O)C6OC | Value: | =8912.5nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | Cc1nnc(N2CCOCC2)c2nn(-c3ccccc3)c(C)c12 | Value: | =2511.9nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | Cc1c(C(=O)NCc2ccccc2Cl)sc2nc3n(c(=O)c12)CCCCC3 | Value: | =19952.6nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | COc1cc(NC(=O)CSCC(=O)Nc2cccc(C(F)(F)F)c2)c(Cl)cc1Cl | Value: | =22387.2nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | Cc1ccc2nc(N3C(=O)CNC3=S)sc2c1 | Value: | =17782.8nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | CC(=O)c1c(C)[nH]c(C(=O)OCC(=O)Nc2sc3c(c2C#N)CCCC3)c1C | Value: | =35481.3nM | Source: | Homo sapiens |
|
 | Assay: | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | Type: | Potency | SMILES: | COc1ccc(C(c2c(O)n(C)c(SC)nc2=O)c2c(O)n(C)c(SC)nc2=O)cc1O | Value: | =10000nM | Source: | Homo sapiens |
|