 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CCOCCNC(=O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =6500nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1)NCCO | | Value: | =6000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1)NCC1CCCO1 | | Value: | =2900nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1)N1CCOCC1 | | Value: | =9700nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CNC(=O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =11000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)NS(=O)(=O)c1ccccc1 | | Value: | =8600nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CS(=O)(=O)NC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | =14000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)N1CCOCC1 | | Value: | =2700nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)Nc1ccccc1 | | Value: | >50000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CCCCNC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | >50000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)N1CCCCC1 | | Value: | >50000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CCN(CC)C(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | >50000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CN(C)C(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | =3100nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CNC(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | =1900nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(O)CCc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =32000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(O)CCc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | =17000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1 | | Value: | =25000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | CS(=O)(=O)NC[C@@H](N)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =1000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | N[C@H](CNC(=O)CCN1CCOCC1)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =1200nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant PCNA interaction with PIP box protein N-5-carboxyfluorescein-SAVLQKKITDYFHPKK after 30 mins by fluorescence polarization assay | | Type: | IC50 | | SMILES: | N[C@H](CNC(=O)N1CCOCC1)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 | | Value: | =1400nM | | Source: | Homo sapiens |
|
