![](every_protein_pic_1_img/CD4/00.png) | Assay: | Inhibitory concentration against CD4-gp120 binding in the absence of fetal bovine serum (FBS); Range is 0.13-0.5 uM | Type: | IC50 | SMILES: | CN1C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]2NC(=O)[C@@H](c3cc(Cl)c(O)c(Cl)c3)NC(=O)[C@H](NC(=O)C(=O)c3cc(Cl)c(O)c(Cl)c3)Cc3c[nH]c4cc(ccc34)-c3cc2cc(c3O)Oc2ccc(cc2)C[C@H]1C(=O)N[C@@H](C(=O)O)c1ccc(O)cc1 | Value: | =130nM | Source: | |
|
![](every_protein_pic_1_img/CD4/01.png) | Assay: | Inhibitory concentration against CD4-gp120 binding in the absence of fetal bovine serum (FBS); Range is 0.13-0.5 uM | Type: | IC50 | SMILES: | CN1C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]2NC(=O)[C@@H](c3cc(Cl)c(O)c(Cl)c3)NC(=O)[C@H](NC(=O)C(=O)c3cc(Cl)c(O)c(Cl)c3)Cc3c[nH]c4c(cccc34)-c3cc2cc(c3O)Oc2ccc(cc2)C[C@H]1C(=O)N[C@@H](C(=O)O)c1ccc(O)cc1 | Value: | =130nM | Source: | |
|
![](every_protein_pic_1_img/CD4/02.png) | Assay: | Inhibitory concentration against CD4-gp120 binding in the absence of fetal bovine serum (FBS); Range is 0.13-0.5 uM | Type: | IC50 | SMILES: | CC(=O)CC(O)(C(=O)N[C@@H]1Cc2c[nH]c3cc(ccc23)-c2cc3cc(c2O)Oc2ccc(cc2)C[C@@H](C(=O)N[C@@H](C(=O)O)c2ccc(O)cc2)N(C)C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]3NC(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC1=O)c1cc(Cl)c(O)c(Cl)c1 | Value: | =130nM | Source: | |
|
![](every_protein_pic_1_img/CD4/03.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)N[C@@H](Cc6ccccc6)C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)N[C@@H](Cc6ccccc6)C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >62000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/04.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCCC(c5cc(Cl)c(O)c(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =73000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/05.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6ccc(C(=O)O)cc6)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccc(C(=O)O)cc6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =22000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/06.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6ccc(-c7cccc(C(=O)O)c7)cc6)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccc(-c7cccc(C(=O)O)c7)cc6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >95000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/07.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =4000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/08.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)N[C@@H](CC(C)C)C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)N[C@@H](CC(C)C)C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >125000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/09.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =69600nM | Source: | |
|
![](every_protein_pic_1_img/CD4/10.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)N[C@@H](CC(=O)O)C(=O)O)c5)c5cc(Cl)c(O)c(C(=O)N[C@@H](CC(=O)O)C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =122000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/11.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6ccccc6C(=O)O)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccccc6C(=O)O)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >37000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/12.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)NCC(=O)O)c5)c5cc(Cl)c(O)c(C(=O)NCC(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >125000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/13.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | COc1c(Cl)cc(Cc2cc(C(=CCC[C@H]3CC[C@@]4(C)C(CC[C@@H]5[C@@H]4CC[C@@]4(C)[C@H]5CC[C@@H]4C(C)CCCC(C)C)C3)c3cc(Cc4cc(Cl)c(OC)c(C(=O)O)c4)c(OC)c(C(=O)O)c3)cc(C(=O)O)c2OC)cc1C(=O)O | Value: | =19900nM | Source: | |
|
![](every_protein_pic_1_img/CD4/14.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6cccc(C(=O)O)c6)c(C(=O)O)c5)c5cc(Cl)c(OCc6cccc(C(=O)O)c6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >29000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/15.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6ccc(-c7ccccc7C(=O)O)cc6)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccc(-c7ccccc7C(=O)O)cc6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | >125000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/16.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCCC(c5cc(Cl)c(OCc6ccc(C(=O)O)cc6)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccc(C(=O)O)cc6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =70400nM | Source: | |
|
![](every_protein_pic_1_img/CD4/17.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(O)c(C(=O)NCCC(=O)O)c5)c5cc(Cl)c(O)c(C(=O)NCCC(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =120000nM | Source: | |
|
![](every_protein_pic_1_img/CD4/18.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](CCC=C(c5cc(Cl)c(OCc6ccc(CC(=O)O)cc6)c(C(=O)O)c5)c5cc(Cl)c(OCc6ccc(CC(=O)O)cc6)c(C(=O)O)c5)CC[C@]4(C)[C@H]3CC[C@@]21C | Value: | =83800nM | Source: | |
|
![](every_protein_pic_1_img/CD4/19.png) | Assay: | In vitro inhibition of cytopathic effect was determined against HIV-2 ROD in MT-4 cells using MTS cytoprotection assay | Type: | EC50 | SMILES: | COc1ccc(C(=O)Nc2cc(C(=CCC[C@H]3CC[C@@]4(C)C(CC[C@@H]5[C@@H]4CC[C@@]4(C)[C@H]5CC[C@@H]4C(C)CCCC(C)C)C3)c3cc(NC(=O)c4ccc(OC)c(C(=O)O)c4)c(OC)c(C(=O)O)c3)cc(C(=O)O)c2OC)cc1C(=O)O | Value: | >66000nM | Source: | |
|