 | | Assay: | In vitro inhibitory concentration against Insulin | | Type: | IC50 | | SMILES: | [H]OC1=CC(O[H])=C2C[C@@H](OC(=O)C3=CC(O[H])=C(O[H])C(O[H])=C3)[C@H](OC2=C1)C4=CC(O[H])=C(O[H])C(O[H])=C4 | | Value: | =17uM | | Source: | |
|
 | | Assay: | In vitro inhibitory concentration against Insulin | | Type: | IC50 | | SMILES: | [H]OC1=CC=C(C=C1)C2(OS(=O)(=O)C3=CC=CC=C23)C4=CC=C(O[H])C=C4 | | Value: | =1.5uM | | Source: | |
|
 | | Assay: | Inhibitory concentration of the compound against insulin (INS) was determined | | Type: | IC50 | | SMILES: | NC1=NNC2=CC(=CC=C12)C1=CC=NC(N)=N1 | | Value: | >10uM | | Source: | |
|
 | | Assay: | Inhibitory concentration of compound against human INSULIN fibril formation upon incubation in 50 mM Tris-Hcl buffer, pH 7.9 | | Type: | IC50 | | SMILES: | [Fe++].OC(=O)C1=CC(SC2=N\O[B-]3(F)ON=C(C4=CC=CC=C4)\C(C4=CC=CC=C4)=N\O[B-](F)(O\N=C\2SC2=CC=CC(=C2)C(O)=O)O\N=C(C2=CC=CC=C2)\C(C2=CC=CC=C2)=N\O3)=CC=C1 | | Value: | =16uM | | Source: | Human |
|
 | | Assay: | Inhibitory concentration of compound against human INSULIN fibril formation upon incubation in 50 mM Tris-Hcl buffer, pH 7.9 | | Type: | IC50 | | SMILES: | [Fe++].[Fe++].OC(=O)C1=CC(SC2=N\O[B-]3(F)ON=C(C4=CC=CC=C4)\C(=N\O[B-](F)(O\N=C(C4=CC=CC=C4)\C(=N\O3)C3=CC=CC=C3)O\N=C\2/C2=N\O[B-]3(F)O\N=C(C4=CC=CC=C4)\C(=NO[B-](F)(O\N=C\2SC2=CC=CC(=C2)C(O)=O)O\N=C(C2=CC=CC=C2)\C(=N\O3)C2=CC=CC=C2)C2=CC=CC=C2)C2=CC=CC=C2)=CC=C1 | | Value: | =24uM | | Source: | Human |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(C=C1)\C=C\C1=NC2=C(S1)C=CC(Cl)=C2 | | Value: | >100000nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=NC3=C(S2)C=CC=C3)C=C1 | | Value: | =1200nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=NC3=C(S2)C=C(C=C3)N(C)C)C=C1 | | Value: | =6000nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=CC=C3)C=C1 | | Value: | =3nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=CC(Cl)=C3)C=C1 | | Value: | =5.2nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=CC(F)=C3)C=C1 | | Value: | =10nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=CC(C)=C3)C=C1 | | Value: | =7.5nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=C(C)C=C3)C=C1 | | Value: | =6nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | COC1=CC2=C(C=C1)[N+](C)=C(S2)\C=C\C1=CC=C(C=C1)N(C)C | | Value: | =8nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(\C=C\C2=[N+](C)C3=C(S2)C=C(C=C3)[N+]([O-])=O)C=C1 | | Value: | =12nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(C=C1)\N=N\C1=NC2=C(S1)C=CC=C2 | | Value: | =1200nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | COC1=CC2=C(C=C1)N=C(S2)\N=N\C1=CC=C(C=C1)N(C)C | | Value: | =700nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(C=C1)\N=N\C1=NC2=C(S1)C=C(Cl)C=C2 | | Value: | =1300nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | COC1=CC2=C(C=C1)[N+](C)=C(S2)\N=N\C1=CC=C(C=C1)N(C)C | | Value: | =10nM | | Source: | |
|
 | | Assay: | Concentration of compound required to displace Thioflavin T fluorescent probe from INSULIN synthetic aggregates determined by measuring decrease in fluorescence | | Type: | AC50 | | SMILES: | CN(C)C1=CC=C(C=C1)\N=N\C1=[N+](C)C2=C(S1)C=CC=C2 | | Value: | =60nM | | Source: | |
|
