| Assay: | Binding affinity to His-tagged FOXO3a (unknown origin) by SPR analysis | Type: | Kd | SMILES: | COc1cc([C@H]2OC[C@@H]3[C@@H](c4cc(OC)c(O)c(OC)c4)OC[C@H]23)cc(OC)c1O | Value: | =1730000nM | Source: | Homo sapiens |
|
| Assay: | Concentration of the compound required for inhibition of FKHRL1 phosphorylation in human PC3 cell line by IP and WB method; Range = 10-40 uM | Type: | Concentration | SMILES: | OC1=CC(O)=C2C(=O)C=C(OC2=C1)C3=CC=C(O)C(O)=C3 | Value: | =40uM | Source: | Human |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | [H][C@@]12CC(CC3=CC=C(C=C3)C3=CC=C(CC4=CC=C(C=C4)N4N=C(N=C4C)C(N)=O)C=C3)C[C@]1([H])CN(C)C2 | Value: | =0.114uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CN(C)C1CCN(CC2=CC=C(C=C2)C2=CC=C(CC3=CC=C(C=C3)N3N=C(C=C3C)C(N)=O)C=C2)CC1 | Value: | =0.032uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CCC[C@H]3CO)C=C2)C=C1)C(N)=O | Value: | =0.048uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CCC4(CCO4)CC3)C=C2)C=C1)C(N)=O | Value: | =0.081uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CC(CO)C3)C=C2)C=C1)C(N)=O | Value: | =0.164uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CCC(CC3)C(F)(F)F)C=C2)C=C1)C(N)=O | Value: | =0.145uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3C[C@H]4[C@H](CO)[C@H]4C3)C=C2)C=C1)C(N)=O | Value: | =0.01uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CC(F)(F)C3)C=C2)C=C1)C(N)=O | Value: | =0.042uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CCS(=O)(=O)CC3)C=C2)C=C1)C(N)=O | Value: | =0.048uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3CCC(CC3)S(C)(=O)=O)C=C2)C=C1)C(N)=O | Value: | =0.049uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CN1CC[C@@H]2CN(CC3=CC=C(C=C3)C3=CC=C(CC4=CC=C(C=C4)N4N=C(N=C4C)C(N)=O)C=C3)C[C@H]12 | Value: | =0.032uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(CC2=CC=C(C=C2)C2=CC=C(CN3C[C@H](O)[C@@H](O)C3)C=C2)C=C1)C(N)=O | Value: | =0.18uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CN1CCCN(CC2=CC=C(C=C2)C2=CC=C(CC3=CC=C(C=C3)N3N=C(N=C3C)C(N)=O)C=C2)CC1 | Value: | =0.039uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=NC(=NN1C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)C1=CC=C(CN2CCCC2)C=C1)C(N)=O | Value: | =0.128uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=CC(=NN1C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)C1=CC=C(C=C1)C1(CN)COC1)C(N)=O | Value: | =0.607uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=CC(=NN1C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)C1=CCC(O)CC1)C(N)=O | Value: | =0.253uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=CC(=NN1C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)C1=CCC(=O)CC1)C(N)=O | Value: | =0.058uM | Source: | |
|
| Assay: | Activation concentration of compound against Phosphorylation mutant FORKHEAD BOX O3A H212R in U2OS cell line upon incubation for 30 mins by HOECHST 33342 ASSAY | Type: | AC50 | SMILES: | CC1=CC(=NN1C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)C1=CC(N)=NC=C1)C(N)=O | Value: | =0.134uM | Source: | |
|