 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | COc1ccc(NC(=O)C#Cc2ccccc2)cc1 | | Value: | =8010nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | COc1ccc(-c2cc(=O)c3ccccc3o2)cc1 | | Value: | =31000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Br.CCCCCCCCCn1c2c(c(=N)c3c1CCC3)CCC2 | | Value: | =9020nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CCCC1CCC(c2ccc(OCC)cc2)=CC1=O | | Value: | =53900nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Cc1nc2ccc(Nc3nc4cc(S(=O)(=O)N5CCOCC5)ccc4o3)cc2s1 | | Value: | >100000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CCN(CC)c1ccc2nc3ccc(N)cc3[n+](-c3ccccc3)c2c1.[Cl-] | | Value: | =4790nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Brc1ccc(-n2cnc(-c3ccccc3)c2)cc1 | | Value: | =35400nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Cl.O=C(CCS(=O)(=O)c1ccccc1)N(CCCN1CCOCC1)c1nc2c(F)cccc2s1 | | Value: | =2070nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Cc1cccn2c(O)c(C(=O)NCCCN3CC(C)CC(C)C3)c(=O)nc12 | | Value: | =14900nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | O=c1c2ccc(Cl)cc2nc(-c2cccc(C(F)(F)F)c2)n1O | | Value: | =11000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | Cc1cccc(N2CCN(CC(O)COc3ccc(Cl)cc3)CC2)c1 | | Value: | =76600nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CCN(CC)CCOc1ccc(C(=C(Cl)c2ccccc2)c2ccccc2)cc1 | | Value: | =29300nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | I.c1ccc(Sc2cccc3ccccc23)c(CNC2=NCCN2)c1 | | Value: | =11700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | N#Cc1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 | | Value: | =3530nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CCN(CC)c1ccc2nc3ccccc3[n+](CC)c2c1.[I-] | | Value: | =14300nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CCCCCC(=O)N1CCN(CC/N=C/C2=C(O)CC(c3ccco3)CC2=O)CC1 | | Value: | =7300nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | COc1ccc(CNC(=O)c2c(C)oc3c2C(=O)c2ccccc2C3=O)cc1 | | Value: | =9700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | CN(CCOc1ccccc1)c1ccc(S(=O)(=O)N2CCCCC2)cn1 | | Value: | >100000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | O=c1c2cc(Br)ccc2nc(-c2ccc([N+](=O)[O-])cc2)n1O | | Value: | =4910nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS for the identification of inhibitors of NALP3 in yeast using a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2825, AID2832] | | Type: | IC50 | | SMILES: | O=C(Nc1scc(-c2ccccc2)c1C(=O)O)c1ccc(F)cc1 | | Value: | =10300nM | | Source: | Homo sapiens |
|
