 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | COc1ccc(CCCOc2cc(CCn3ccnc3)ccc2OC)cc1 | | Value: | 29092.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | c1ccc2c(c1)[I+]c1ccccc1-2 | | Value: | 7307.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | Cc1cc2c(cc1Cl)N(C(=O)Nc1ccc(Oc3cccnc3C)nc1)CC2 | | Value: | 7307.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | Fc1ccc(C(OCCN2CCN(CCCc3ccccc3)CC2)c2ccc(F)cc2)cc1 | | Value: | 25929nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO | | Value: | 4610.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CC1OC(n2cc(F)c(=O)[nH]c2=O)C(O)C1O | | Value: | 23109.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | Cc1ccc(O)c(/N=N/c2ccccc2)n1 | | Value: | 29092.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | COc1cc([C@@H]2c3cc4c(cc3[C@H](O)C3COC(=O)[C@@H]32)OCO4)cc(OC)c1OC | | Value: | 13nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CC1(C)C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc21 | | Value: | 20596.2nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | C[C@@H](Cc1ccc(O)c(O)c1)[C@H](C)Cc1ccc(O)c(O)c1 | | Value: | 3662.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2C1CCCC1 | | Value: | 23109.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1 | | Value: | 14581nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CCCC(=O)NCCc1c2n(c3ccc(OC)cc13)CCCc1ccccc1-2 | | Value: | 16360.1nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CC(C)(C)c1cc(C=C(C#N)C#N)cc(C(C)(C)C)c1O | | Value: | 1835.6nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 | | Value: | 16360.1nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](O)C[C@H]3OC[C@@]3(OC(C)=O)[C@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)c3ccccc3)c3ccccc3)C(C)=C1C2(C)C | | Value: | 2310.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 | | Value: | 580.5nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | N=C(N)N1CCc2ccccc2C1.N=C(N)N1CCc2ccccc2C1.O=S(=O)(O)O | | Value: | 16360.1nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | CC12CC3CC(C)(C1)CC(N)(C3)C2 | | Value: | 23109.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors: Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493163, AID504444, AID504648] | | Type: | Potency | | SMILES: | O=C1C(SCCO)=C(SCCO)C(=O)c2ccccc21 | | Value: | 29092.9nM | | Source: | Homo sapiens |
|
