 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)NC1CCCCC1 | | Value: | =605000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)Nc1ccccc1 | | Value: | =380000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)NCc1ccccc1 | | Value: | =760000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | COc1cccc(NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2ccc(OP(=O)(O)O)cc2)NC(=O)c2ccc(C#N)cc2)c1 | | Value: | =560000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1 | | Value: | =250000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)NCc1ccncc1 | | Value: | =402000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)O | | Value: | =42000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1)C(=O)NCCCO | | Value: | =210000nM | | Source: | |
|
 | | Assay: | Inhibition of STAT1 dimer DNA binding activity after 30 mins | | Type: | IC50 | | SMILES: | CC(C)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C#N)cc1 | | Value: | =760000nM | | Source: | |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | Cc1cc(OCC(=O)Nc2ccncc2)ccc1Br | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | C[C@H]1O[C@@H](O[C@H]2[C@@H](O)C[C@H](O[C@H]3[C@@H](O)C[C@H](O[C@H]4CC[C@]5(C)[C@H]6CC[C@]7(C)[C@@H](C8=CC(=O)OC8)CC[C@]7(O)[C@@H]6CC[C@@H]5C4)O[C@@H]3C)O[C@@H]2C)C[C@H](O)[C@@H]1O | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | O=C(NC1CC1)c1cc2c(s1)-c1ccccc1OC2 | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CCOc1cc(C(=S)N2CCOCC2)ccc1OS(=O)(=O)c1ccc(NC(C)=O)cc1 | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | COc1ccc2nc3c(cc2c1)c(NC(=O)c1cccs1)nn3CC(C)C | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CCCCCCCc1ccc(-c2ccc(O)cc2)nc1 | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CN1/C(=C\C(=O)C[n+]2ccc3ccccc3c2)C(C)(C)c2ccccc21.[Cl-] | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CCc1c(C)c2ccc(OCC(=O)OC(C)C)c(C)c2oc1=O | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CN(C)S(=O)(=O)Oc1cccc(C(=O)Nc2ccc(Cl)cc2)c1 | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | CCCOc1ccc(/C=N/NC(=S)Nc2ccccc2[N+](=O)[O-])c(O)c1 | | Value: | >55700nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: Dose response counterscreen assay for STAT3 inhibitors: cell-based high throughput assay to measure STAT1 inhibition. (Class of assay: confirmatory) [Related pubchem assays: 920, 1317, 1265, 1308, 862 ] | | Type: | IC50 | | SMILES: | COc1ccc(/C=N/NC(=S)Nc2cccc(C(=O)O)c2)cc1 | | Value: | =32590nM | | Source: | Homo sapiens |
|
