 | | Assay: | Antagonistic potency at human TLR4 expressed in HEK293 cells | | Type: | IC50 | | SMILES: | CCCCCCCCCCCCCC(=O)N[C@H](COCC[C@@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O | | Value: | =350nM | | Source: | Homo sapiens |
|
 | | Assay: | Antagonistic potency at human TLR4 expressed in HEK293 cells | | Type: | IC50 | | SMILES: | CCCCCCCCCCCCCC(=O)N[C@@H](COCC[C@@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O | | Value: | =250nM | | Source: | Homo sapiens |
|
 | | Assay: | Antagonistic potency at human TLR4 expressed in HEK293 cells | | Type: | IC50 | | SMILES: | CCCCCCCCCCCCCC(=O)N[C@@H](COCC[C@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O | | Value: | =80nM | | Source: | Homo sapiens |
|
 | | Assay: | Antagonistic potency at human TLR4 expressed in HEK293 cells | | Type: | IC50 | | SMILES: | CCCCCCCCCCCCCC(=O)N[C@H](COCC[C@H](CCCCCCC)OC(=O)CCCCCCCCCCC)COP(=O)(O)OCCNC(=O)C(Cc1ccc(O)cc1)C(=O)O | | Value: | =160nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O.CC[C@H](C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCN)NC1=O)[C@@H](C)O | | Value: | =1230nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCCCCCCCCCCCCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCCCCCCCCCCCCCC.Cl.Cl | | Value: | =190000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCCCCCCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCCCCCCCC.Cl.Cl | | Value: | =4500nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCCCCOc1c(/C=N/N=C(N)N)ccc(/C=N/NC(=N)N)c1OCCCCCC.Cl.Cl | | Value: | =6110nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCCCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCCCCC.Cl.Cl | | Value: | =10500nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCCOc1c(/C=N/N=C(N)N)ccc(/C=N/NC(=N)N)c1OCCCC.Cl.Cl | | Value: | =9400nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | C=CCOc1c(/C=N/NC(=N)N)ccc(/C=N/NC(=N)N)c1OCC=C.Cl.Cl | | Value: | =61400nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCCC.Cl.Cl | | Value: | =27600nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | CCOc1c(/C=N/N=C(N)N)ccc(/C=N/N=C(N)N)c1OCC.Cl.Cl | | Value: | =35600nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | COc1c(/C=N/N=C(N)N)ccc(/C=N/NC(=N)N)c1OC.Cl.Cl | | Value: | =175000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | Cl.Cl.N=C(N)N/N=C/c1ccc(/C=N/NC(=N)N)c(O)c1O | | Value: | =59100nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of induction of NF-kappaB by LPS in HEK293 cells co-transfected with TLR4, CD14 and MD2 | | Type: | IC50 | | SMILES: | Cl.Cl.N=C(N)N/N=C/c1ccc(/C=N/NC(=N)N)cc1 | | Value: | =164000nM | | Source: | Homo sapiens |
|
 | | Assay: | Antagonist activity at TLR4 in human PBMC assessed as inhibition of LPS-stimulated TNFalpha production pre-incubated for 30 mins before LPS challenge measured after 18 hrs by ELISA | | Type: | IC50 | | SMILES: | CCCCCCCCCCC[C@H](CC(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCC)[C@H]1NC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCC)C(=O)O)OC(=O)CCCCC | | Value: | =2.4nM | | Source: | Homo sapiens |
|
 | | Assay: | Antagonist activity at TLR4 in human PBMC assessed as inhibition of LPS-stimulated TNFalpha production pre-incubated for 30 mins before LPS challenge measured after 18 hrs by ELISA | | Type: | IC50 | | SMILES: | CCCCCCCCCCC[C@H](CC(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OCCCCCC)[C@H]1NC(=O)C[C@@H](CCCCCCCCCCC)OCCCCCC)C(=O)O)OCCCCCC | | Value: | =5.3nM | | Source: | Homo sapiens |
|
 | | Assay: | Agonist activity at TLR4 in human PBMC assessed as induction of TNFalpha production after 18 hrs by sandwich ELISA | | Type: | ED50 | | SMILES: | CCCCCCCCCCC[C@H](CC(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCC)[C@H]1NC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCC)C(=O)O)OC(=O)CCCCCCCCC | | Value: | =0.39nM | | Source: | Homo sapiens |
|
 | | Assay: | Agonist activity at TLR4 in human PBMC assessed as induction of TNFalpha production after 18 hrs by sandwich ELISA | | Type: | ED50 | | SMILES: | CCCCCCCCCCC[C@H](CC(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H](OC(=O)C[C@@H](CCCCCCCCCCC)OCCCCCCCCCC)[C@H]1NC(=O)C[C@@H](CCCCCCCCCCC)OCCCCCCCCCC)C(=O)O)OCCCCCCCCCC | | Value: | =0.17nM | | Source: | Homo sapiens |
|
