 | | Assay: | Inhibition of human recombinant 92 kDa gelatinase MMP-9 at 100 uM | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](CC(=O)NO)CC(C)C | | Value: | =0.2nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human recombinant Gelatinase B (MMP-9) | | Type: | IC50 | | SMILES: | CCCCCCCCC[C@H](CC(=O)NO)C(=O)N[C@H](C(=O)NC)C(C)(C)C | | Value: | =1.5nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1[C@@H](CSc2ccccc2)[C@@H]1COCC(=O)NO | | Value: | =36000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](NC(=O)[C@@H](CC(=O)NO)CC(C)C)C(C)(C)C | | Value: | =10.4nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](NC(=O)[C@H](CC(C)C)[C@@H](C)C(=O)NO)C(C)(C)C | | Value: | =2.4nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](NC(=O)[C@H](CC(C)C)[C@@H](CN1C(=O)c2ccccc2C1=O)C(=O)NO)C(C)(C)C | | Value: | =4.3nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CC(C)C[C@@H](C(=O)N1CCCCC1)[C@@H](CN1C(=O)N(C)C(C)(C)C1=O)C(=O)NO | | Value: | =237nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CNC(=O)[C@H](NC(=O)[C@H](CC(C)C)[C@@H](CN1C(=O)N(C)C(C)(C)C1=O)C(=O)NO)C(C)(C)C | | Value: | =2.8nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of human gelatinase B, MMP9 | | Type: | IC50 | | SMILES: | CN1C(=O)N(C[C@@H](C(=O)NO)[C@@H](CC2CCCC2)C(=O)N2CCCCC2)C(=O)C1(C)C | | Value: | =59nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CCCCCCCCOc1ccc(CC2(C)C(=O)NC(=O)NC2=O)cc1 | | Value: | =164nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | O=C1NC(=O)C(c2ccc(Oc3ccccc3)cc2)C(=O)N1 | | Value: | =14000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CCCCCCC1(c2ccc(-c3ccccc3)cc2)C(=O)NC(=O)NC1=O | | Value: | =863nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CN1C(=O)NC(=O)C(C)(c2ccc(Oc3ccccc3)cc2)C1=O | | Value: | >50000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | O=C1NC(=O)C(CCO)(c2ccc(Oc3ccccc3)cc2)C(=O)N1 | | Value: | =118nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CCCCCCC1(c2ccc(Oc3ccccc3)cc2)C(=O)NC(=O)NC1=O | | Value: | =18nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | O=C1NC(=O)C(COCc2ccccc2)(c2ccc(Oc3ccccc3)cc2)C(=O)N1 | | Value: | =17nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CCCCCCC1(c2ccc(-c3ccccc3)cc2)C(=O)NC(=S)NC1=O | | Value: | =12000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CCCCCCC1(c2ccccc2)C(=O)NC(=O)NC1=O | | Value: | =330nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CC1(c2ccc(Oc3ccccc3)cc2)C(=O)NC(=O)NC1=O | | Value: | =52nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Gelatinase B, matrix metalloprotease-9 | | Type: | IC50 | | SMILES: | CC1(c2ccccc2)C(=O)NC(=O)NC1=O | | Value: | =11000nM | | Source: | Homo sapiens |
|
