Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: CCOC(=O)C1CCC(=O)C=C1C Value: =410000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-n2ccnc2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1cncc(-c2nc3ccccc3[nH]2)c1 Value: =410000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2c[nH]cn2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: Cc1cc(=O)oc2ccc(O)cc12 Value: =760000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: O=S(=O)(NC1CCCCC1)c1ccccc1 Value: =500000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: CCCCSC(=O)C1CC(=O)NC(=O)C1 Value: =190000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2cc[nH]n2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2nc3ccccc3[nH]2)nc1 Value: =60000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2ncc[nH]2)cc1 Value: =100000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: CCN(CC)c1ccc2c(C)cc(=O)oc2c1 Value: =130000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: Cc1cc(=O)oc2cc(O)c(O)cc12 Value: =1500000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2nn[nH]n2)nc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2ccno2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-n2cccc2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: O=S(=O)(Nc1ccccc1)c1ccccc1 Value: =1000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2nc[nH]n2)cc1 Value: =4000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-n2cccn2)cc1 Value: >10000000nM Source:
	Assay: Dissociation constant when binding to FK506 binding protein (FKBP). Type: Kd SMILES: c1ccc(-c2nnn[nH]2)cc1 Value: >10000000nM Source:
	Assay: The inhibitory activity by using FK506 binding protein 12 SPA binding assay Type: IC50 SMILES: C=CC[C@@H]1/C=C(\C)C[C@H](C)C[C@H](OC)[C@H]2O[C@@](O)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@H](/C(C)=C/[C@@H]3CC[C@@H](O)[C@H](OC)C3)[C@H](C)[C@@H](O)CC1=O)[C@H](C)C[C@@H]2OC Value: =3.162nM Source:

Note: If you'd like to learn how our AI-powered BDE-Chem can help design therapeutic molecules against the MTOR target, that break through the existing patents, at a cost 90% lower than traditional approaches, please feel free to contact us at BD@silexon.ai

Molecules for More Common Targets

ABCB1 | ABCG2 | ACE2 | AHR | AKT1 | ALK | AR | ATM | BAX | BCL2 | BCL2L1 | BRAF | BRCA1 | CASP3 | CASP9 | CCL5 | CCND1 | CD274 | CD4 | CDKN1A | CXCL8 | CXCR4 | DNMT1 | EGF | EGFR | EP300 | ERBB2 | ESR1 | EZH2 | FN1 | FOXO3 | HDAC9 | HGF | HMGB1 | HSP90AA1 | HSPA5 | IDO1 | IGF1 | IGF1R | IL17A | IL6 | INS | JUN | KRAS | MAPK1 | MAPK14 | MAPK3 | MAPK8 | MAPT | MCL1 | MMP9 | MTOR | MYC | NFE2L2 | NLRP3 | NOTCH1 | PARP1 | PCNA | PDCD1 | PLK1 | PRKAA1 | PRKAA2 | PTEN | PTGS2 | PTK2 | RELA | SIRT1 | SRC | STAT1 | STAT3 | STAT5A | TERT | TLR4 | TNF | TP53 | TXN | VEGFA | YAP1