 | | Assay: | Inhibition of STAT5 phosphorylation in IL2-stimulated healthy human T cells by Western blotting | | Type: | IC50 | | SMILES: | O=C1NCc2c1c1c3ccccc3n3c1c1c2c2ccccc2n1C[C@@H](O)[C@@H](O)C3 | | Value: | =689nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Stat5 phosphorylation in human SET2 cells after 1 hr by Western blotting | | Type: | IC50 | | SMILES: | Cc1cc(Nc2nc(N[C@@H](C)c3ncc(F)cn3)ncc2Cl)[nH]n1 | | Value: | =25nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Stat5 phosphorylation in human HEL cells after 1 hr by Western blotting | | Type: | IC50 | | SMILES: | Cc1cc(Nc2nc(N[C@@H](C)c3ncc(F)cn3)ncc2Cl)[nH]n1 | | Value: | =41nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to His-tagged STAT5 (unknown origin) by SPR spectroscopic analysis | | Type: | Kd | | SMILES: | CN(CC(=O)N(Cc1ccc(C2CCCCC2)cc1)c1ccc(C(=O)O)cc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F | | Value: | =464nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of STAT5 DNA binding activity in human K562 cells after 24 hrs by electrophoretic mobility shift assay | | Type: | IC50 | | SMILES: | Cc1cc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)ccc1F | | Value: | =5nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of STAT5 (unknown origin) | | Type: | IC50 | | SMILES: | O=C(N/N=C/c1coc2ccccc2c1=O)c1cccnc1 | | Value: | =47000nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3ccc(F)cc3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =7200nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3ccc(Cl)cc3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =8900nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3ccc(Br)cc3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =7600nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3cccc(F)c3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =8400nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3cccc(Cl)c3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =7300nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3cccc(Br)c3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =10600nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2ccccc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =9700nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2ccc(F)cc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =8300nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2ccc(Cl)cc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =7400nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2ccc(Br)cc2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =8600nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2cccc(F)c2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =11900nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2cccc(Cl)c2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =9100nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from STAT5A SH2 domain (unknown origin) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc(C(=O)Nc2cccc(Br)c2)cc1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =10500nM | | Source: | Homo sapiens |
|
 | | Assay: | Displacement of 5-carboxyfluorescein-GY(PO3H2)LVLDKW from C-terminal His6-tagged/N-terminal maltose-binding protein-tagged STAT5A SH2 domain (unknown origin) (137 to 707 residues) Escherichia coli BL21(DE3) pretreated for 1 hr followed by fluorescent tracer addition after 1 hr by fluorescence polarization assay | | Type: | IC50 | | SMILES: | O=C(COc1ccc2cc(C(=O)Nc3ccccc3)ccc2c1)NCc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1 | | Value: | =4970nM | | Source: | Homo sapiens |
|
