 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | COc1ccc(C2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N2C(=O)N2CCNC(=O)C2)c(OC(C)C)c1 | | Value: | =1390nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | Cc1ccc2c(c1)C1=C(C(c3ccc(Br)cc3)O2)C(c2ccc(Br)cc2)n2ncnc2N1C | | Value: | =3000nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | Cc1cc2c(cc1F)OC(c1ccc(Br)cc1)C1=C2N(C)c2ncnn2C1c1ccc(Br)cc1 | | Value: | =11400nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | CN1C2=C(C(c3ccc(Br)cc3)Oc3ccc(F)cc32)C(c2ccc(Br)cc2)n2ncnc21 | | Value: | =44300nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | CCOc1cccc2c1C1=C(C(c3ccc(Br)cc3)O2)C(c2ccc(Br)cc2)n2ncnc2N1C | | Value: | =6500nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | CN1C2=C(C(c3ccc(Cl)cc3)Oc3ccccc32)C(c2ccc(Br)cc2)n2ncnc21 | | Value: | =15000nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53 in human HCT116 cells coexpressing pp53TA-luc assessed as inhibition of cell proliferation after 8 hrs by firefly/renilla luciferase reporter assay | | Type: | IC50 | | SMILES: | CN1C2=C(C(c3ccc(Cl)cc3)Oc3ccccc32)C(c2ccc(Cl)cc2)n2ncnc21 | | Value: | =9370nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53-Ser15 phosphorylation in human HCT116 cells after 24 hrs | | Type: | IC50 | | SMILES: | COc1ccc(C2=N[C@@H](c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N2C(=O)N2CCNC(=O)C2)c(OC(C)C)c1 | | Value: | =1000nM | | Source: | Homo sapiens |
|
 | | Assay: | Induction of p53-Ser15 phosphorylation in human HCT116 cells after 24 hrs | | Type: | IC50 | | SMILES: | Cc1ccc2c(c1)C1=C(C(c3ccc(Br)cc3)O2)C(c2ccc(Br)cc2)n2ncnc2N1C | | Value: | =1000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | CCC(C)NC(=O)Cn1c(=O)n(Cc2ccc(C(=O)NCc3ccc(C)cc3)cc2)c(=O)c2ccccc21 | | Value: | =15848.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | CCn1c(CN2CCCCC2)nc2cc(NC(=O)COc3cc(C)ccc3C(C)C)ccc21 | | Value: | =31622.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | COc1ccc(-c2cc(C(F)(F)F)n3nc(C(=O)NCC45CC6CC(CC(C6)C4)C5)cc3n2)cc1 | | Value: | =31622.8nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | CCN(c1ccccc1)S(=O)(=O)c1nnc(NC(=O)c2cccs2)s1 | | Value: | =1258.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | Cc1ccc(N2CCN(C(=O)c3cnn(-c4ccc(F)cc4F)c3C3CCN(C(=O)OC(C)(C)C)CC3)CC2)c(C)c1 | | Value: | =12589.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | COc1cc(OC)cc(C(=O)Nc2ccc3c(c2)OCCO3)c1 | | Value: | =7943.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | COc1ccc2nc(N3CCN(C(=O)C4CC4)CC3)sc2c1 | | Value: | =12589.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | CCCCN(CC)CCCNC(=O)C1CCN(c2nc3ccc(CC)cc3s2)CC1 | | Value: | =10000nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | O=C1c2cccc(OCC(=O)N3N=C(c4cccs4)CC3c3ccc(F)cc3)c2CCN1Cc1ccccc1 | | Value: | =3162.3nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | O=S(=O)(NCc1ccccc1)c1ccc2[nH]c3c(c2c1)CCCCC3 | | Value: | =15848.9nM | | Source: | Homo sapiens |
|
 | | Assay: | PUBCHEM_BIOASSAY: qHTS Screen for Compounds that Selectively Target Cancer Cells with p53 Mutations: Cytotoxicity of p53 Null Cells at the Permissive Temperature. (Class of assay: confirmatory) | | Type: | Potency | | SMILES: | CCCOc1ccc(-c2nc3ccccc3c(=O)o2)cc1 | | Value: | =15848.9nM | | Source: | Homo sapiens |
|
